C7H15NO2S — CID 103705550
2-(3-hydroxybutan-2-ylsulfanyl)-N-methylacetamide (PubChem CID 103705550) has the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-(3-hydroxybutan-2-ylsulfanyl)-N-methylacetamide.
| Compound Name | 2-(3-hydroxybutan-2-ylsulfanyl)-N-methylacetamide |
|---|---|
| PubChem CID | 103705550 |
| Molecular Formula | C7H15NO2S |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-(3-hydroxybutan-2-ylsulfanyl)-N-methylacetamide |
| SMILES | CNC(=O)CSC(C)C(C)O |
| InChI | InChI=1S/C7H15NO2S/c1-5(9)6(2)11-4-7(10)8-3/h5-6,9H,4H2,1-3H3,(H,8,10) |
| InChIKey | OPLISPTZWBMHBU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |