C32H56O4Si2 — CID 10370581
(1E,6E)-3-methyl-7-[(6S)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepan-6-yl]-1-(2,6,6-trimethylcyclohexen-1-yl)octa-1,6-dien-4-yn-3-ol (PubChem CID 10370581) has the molecular formula C32H56O4Si2 and a molecular weight of 560.97 g/mol. Its IUPAC name is (1E,6E)-3-methyl-7-[(6S)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepan-6-yl]-1-(2,6,6-trimethylcyclohexen-1-yl)octa-1,6-dien-4-yn-3-ol.
| Compound Name | (1E,6E)-3-methyl-7-[(6S)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepan-6-yl]-1-(2,6,6-trimethylcyclohexen-1-yl)octa-1,6-dien-4-yn-3-ol |
|---|---|
| PubChem CID | 10370581 |
| Molecular Formula | C32H56O4Si2 |
| Molecular Weight | 560.97 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | (1E,6E)-3-methyl-7-[(6S)-2,2,4,4-tetra(propan-2-yl)-1,3,5,2,4-trioxadisilepan-6-yl]-1-(2,6,6-trimethylcyclohexen-1-yl)octa-1,6-dien-4-yn-3-ol |
| SMILES | CC1=C(/C=C/C(C)(O)C#C/C=C(\C)[C@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O2)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H56O4Si2/c1-23(2)37(24(3)4)34-22-30(35-38(36-37,25(5)6)26(7)8)28(10)17-15-20-32(13,33)21-18-29-27(9)16-14-19-31(29,11)12/h17-18,21,23-26,30,33H,14,16,19,22H2,1-13H3/b21-18+,28-17+/t30-,32?/m1/s1 |
| InChIKey | CVFHLSMXGJZJES-GASHCWHWSA-N |
| XLogP | 8.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.97 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|