C34H47N3O4 — CID 10370604
bis[2-[benzyl(methyl)amino]ethyl] 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10370604) has the molecular formula C34H47N3O4 and a molecular weight of 561.77 g/mol. Its IUPAC name is bis[2-[benzyl(methyl)amino]ethyl] 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[2-[benzyl(methyl)amino]ethyl] 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10370604 |
| Molecular Formula | C34H47N3O4 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | bis[2-[benzyl(methyl)amino]ethyl] 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCCCC1C(C(=O)OCCN(C)Cc2ccccc2)=C(C)NC(C)=C1C(=O)OCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C34H47N3O4/c1-6-7-10-19-30-31(33(38)40-22-20-36(4)24-28-15-11-8-12-16-28)26(2)35-27(3)32(30)34(39)41-23-21-37(5)25-29-17-13-9-14-18-29/h8-9,11-18,30,35H,6-7,10,19-25H2,1-5H3 |
| InChIKey | XXRUFGGDEFYXSG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|