C27H32ClN11O — CID 10370609
1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-2-[3-(2,6-diaminopurin-9-yl)propyl]guanidine (PubChem CID 10370609) has the molecular formula C27H32ClN11O and a molecular weight of 562.08 g/mol. Its IUPAC name is 1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-2-[3-(2,6-diaminopurin-9-yl)propyl]guanidine.
| Compound Name | 1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-2-[3-(2,6-diaminopurin-9-yl)propyl]guanidine |
|---|---|
| PubChem CID | 10370609 |
| Molecular Formula | C27H32ClN11O |
| Molecular Weight | 562.08 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butyl]-2-[3-(2,6-diaminopurin-9-yl)propyl]guanidine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCCN/C(N)=N/CCCn3cnc4c(N)nc(N)nc43)c2c1 |
| InChI | InChI=1S/C27H32ClN11O/c1-40-17-6-8-20-19(14-17)22(18-7-5-16(28)13-21(18)36-20)32-9-2-3-10-33-26(30)34-11-4-12-39-15-35-23-24(29)37-27(31)38-25(23)39/h5-8,13-15H,2-4,9-12H2,1H3,(H,32,36)(H3,30,33,34)(H4,29,31,37,38) |
| InChIKey | TVLFGJXVTJSOER-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 180.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.08 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|