C35H37N3O4 — CID 10370655
(3S,6S)-6-(4-aminobutyl)-3-[[4-[3-(hydroxymethyl)phenoxy]phenyl]methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione (PubChem CID 10370655) has the molecular formula C35H37N3O4 and a molecular weight of 563.70 g/mol. Its IUPAC name is (3S,6S)-6-(4-aminobutyl)-3-[[4-[3-(hydroxymethyl)phenoxy]phenyl]methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-6-(4-aminobutyl)-3-[[4-[3-(hydroxymethyl)phenoxy]phenyl]methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 10370655 |
| Molecular Formula | C35H37N3O4 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | (3S,6S)-6-(4-aminobutyl)-3-[[4-[3-(hydroxymethyl)phenoxy]phenyl]methyl]-1-[(4-phenylphenyl)methyl]piperazine-2,5-dione |
| SMILES | NCCCC[C@H]1C(=O)N[C@@H](Cc2ccc(Oc3cccc(CO)c3)cc2)C(=O)N1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H37N3O4/c36-20-5-4-11-33-34(40)37-32(22-25-14-18-30(19-15-25)42-31-10-6-7-27(21-31)24-39)35(41)38(33)23-26-12-16-29(17-13-26)28-8-2-1-3-9-28/h1-3,6-10,12-19,21,32-33,39H,4-5,11,20,22-24,36H2,(H,37,40)/t32-,33-/m0/s1 |
| InChIKey | CDVJSFFRVDMYSE-LQJZCPKCSA-N |
| XLogP | 5.21 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|