C30H39N5O4S — CID 10370697
3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-1-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione (PubChem CID 10370697) has the molecular formula C30H39N5O4S and a molecular weight of 565.74 g/mol. Its IUPAC name is 3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-1-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-1-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10370697 |
| Molecular Formula | C30H39N5O4S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 3-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-1-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N1CCC3(CCc4ccccc43)CC1)[C@@H](N1C(=O)CN(Cc3cnc[nH]3)C1=O)C2 |
| InChI | InChI=1S/C30H39N5O4S/c1-28(2)22-8-10-30(28,25(15-22)35-26(36)18-33(27(35)37)17-23-16-31-20-32-23)19-40(38,39)34-13-11-29(12-14-34)9-7-21-5-3-4-6-24(21)29/h3-6,16,20,22,25H,7-15,17-19H2,1-2H3,(H,31,32)/t22-,25+,30-/m1/s1 |
| InChIKey | ORUIMDPDDQOBCV-YDIMZXDKSA-N |
| XLogP | 3.68 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|