C31H46N2O8 — CID 10370881
[1,4-bis[(3,4,5-trimethoxyphenyl)methyl]piperazin-2-yl]methyl 2-ethylbutanoate (PubChem CID 10370881) has the molecular formula C31H46N2O8 and a molecular weight of 574.72 g/mol. Its IUPAC name is [1,4-bis[(3,4,5-trimethoxyphenyl)methyl]piperazin-2-yl]methyl 2-ethylbutanoate.
| Compound Name | [1,4-bis[(3,4,5-trimethoxyphenyl)methyl]piperazin-2-yl]methyl 2-ethylbutanoate |
|---|---|
| PubChem CID | 10370881 |
| Molecular Formula | C31H46N2O8 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | [1,4-bis[(3,4,5-trimethoxyphenyl)methyl]piperazin-2-yl]methyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCC1CN(Cc2cc(OC)c(OC)c(OC)c2)CCN1Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C31H46N2O8/c1-9-23(10-2)31(34)41-20-24-19-32(17-21-13-25(35-3)29(39-7)26(14-21)36-4)11-12-33(24)18-22-15-27(37-5)30(40-8)28(16-22)38-6/h13-16,23-24H,9-12,17-20H2,1-8H3 |
| InChIKey | YBFGTQXXZOBAGN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |