C10H13NO3 — CID 103708956
N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 103708956) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 103708956 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | C#CCCCNC(=O)C1=COCCO1 |
| InChI | InChI=1S/C10H13NO3/c1-2-3-4-5-11-10(12)9-8-13-6-7-14-9/h1,8H,3-7H2,(H,11,12) |
| InChIKey | XFRQGSYZKIYVIJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|