About N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide
N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 103708956) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide.
Molecular Properties
| Compound Name | N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide |
| PubChem CID | 103708956 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | C#CCCCNC(=O)C1=COCCO1 |
| InChI | InChI=1S/C10H13NO3/c1-2-3-4-5-11-10(12)9-8-13-6-7-14-9/h1,8H,3-7H2,(H,11,12) |
| InChIKey | XFRQGSYZKIYVIJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide?
The IUPAC name of N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide (CID 103708956) is N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide.
What is the SMILES notation for N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide?
The canonical SMILES for N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide is C#CCCCNC(=O)C1=COCCO1.
What is the InChIKey of N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide?
The InChIKey is XFRQGSYZKIYVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-2-3-4-5-11-10(12)9-8-13-6-7-14-9/h1,8H,3-7H2,(H,11,12).
What are the key properties of N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide?
N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide has a molecular weight of 195.22 g/mol, XLogP of 0.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pent-4-ynyl-2,3-dihydro-1,4-dioxine-5-carboxamide is sourced from PubChem (CID 103708956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).