C33H38ClN3O4 — CID 10370910
4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N,N-diethylbutanamide (PubChem CID 10370910) has the molecular formula C33H38ClN3O4 and a molecular weight of 576.14 g/mol. Its IUPAC name is 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N,N-diethylbutanamide.
| Compound Name | 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 10370910 |
| Molecular Formula | C33H38ClN3O4 |
| Molecular Weight | 576.14 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 4-[4-[(2S,4R)-4-(N-acetyl-4-chloroanilino)-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl]phenoxy]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCOc1ccc(C(=O)N2c3ccccc3[C@H](N(C(C)=O)c3ccc(Cl)cc3)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C33H38ClN3O4/c1-5-35(6-2)32(39)12-9-21-41-28-19-13-25(14-20-28)33(40)36-23(3)22-31(29-10-7-8-11-30(29)36)37(24(4)38)27-17-15-26(34)16-18-27/h7-8,10-11,13-20,23,31H,5-6,9,12,21-22H2,1-4H3/t23-,31+/m0/s1 |
| InChIKey | FVGCHOVSVZXENL-GTYOFVGBSA-N |
| XLogP | 6.90 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.14 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|