C25H19Cl2IN2O2 — CID 10370933
3-[1-(3,4-dichlorophenyl)-5-(4-methylphenyl)pyrazol-3-yl]-2-(3-iodophenyl)propanoic acid (PubChem CID 10370933) has the molecular formula C25H19Cl2IN2O2 and a molecular weight of 577.25 g/mol. Its IUPAC name is 3-[1-(3,4-dichlorophenyl)-5-(4-methylphenyl)pyrazol-3-yl]-2-(3-iodophenyl)propanoic acid.
| Compound Name | 3-[1-(3,4-dichlorophenyl)-5-(4-methylphenyl)pyrazol-3-yl]-2-(3-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 10370933 |
| Molecular Formula | C25H19Cl2IN2O2 |
| Molecular Weight | 577.25 g/mol |
| Exact Mass | 575.99 |
| IUPAC Name | 3-[1-(3,4-dichlorophenyl)-5-(4-methylphenyl)pyrazol-3-yl]-2-(3-iodophenyl)propanoic acid |
| SMILES | Cc1ccc(-c2cc(CC(C(=O)O)c3cccc(I)c3)nn2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H19Cl2IN2O2/c1-15-5-7-16(8-6-15)24-13-19(29-30(24)20-9-10-22(26)23(27)14-20)12-21(25(31)32)17-3-2-4-18(28)11-17/h2-11,13-14,21H,12H2,1H3,(H,31,32) |
| InChIKey | DJCASDRCLSPJKE-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.25 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|