C20H26BrN3O3 — CID 1037096
(3R)-1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N,N-diethylpiperidine-3-carboxamide (PubChem CID 1037096) has the molecular formula C20H26BrN3O3 and a molecular weight of 436.35 g/mol. Its IUPAC name is (3R)-1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 1037096 |
| Molecular Formula | C20H26BrN3O3 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (3R)-1-[(3R)-1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN([C@@H]2CC(=O)N(c3ccc(Br)cc3)C2=O)C1 |
| InChI | InChI=1S/C20H26BrN3O3/c1-3-22(4-2)19(26)14-6-5-11-23(13-14)17-12-18(25)24(20(17)27)16-9-7-15(21)8-10-16/h7-10,14,17H,3-6,11-13H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | MYIJCHMIRGSJHK-RHSMWYFYSA-N |
| XLogP | 2.66 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|