C39H46O4 — CID 10370975
[(4R,5R)-5-[bis(3,5-dimethylphenyl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,5-dimethylphenyl)methanol (PubChem CID 10370975) has the molecular formula C39H46O4 and a molecular weight of 578.79 g/mol. Its IUPAC name is [(4R,5R)-5-[bis(3,5-dimethylphenyl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,5-dimethylphenyl)methanol.
| Compound Name | [(4R,5R)-5-[bis(3,5-dimethylphenyl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 10370975 |
| Molecular Formula | C39H46O4 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | [(4R,5R)-5-[bis(3,5-dimethylphenyl)-hydroxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-bis(3,5-dimethylphenyl)methanol |
| SMILES | Cc1cc(C)cc(C(O)(c2cc(C)cc(C)c2)[C@@H]2OC(C)(C)O[C@H]2C(O)(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C39H46O4/c1-23-11-24(2)16-31(15-23)38(40,32-17-25(3)12-26(4)18-32)35-36(43-37(9,10)42-35)39(41,33-19-27(5)13-28(6)20-33)34-21-29(7)14-30(8)22-34/h11-22,35-36,40-41H,1-10H3/t35-,36-/m1/s1 |
| InChIKey | JESRVWZRKUOLTE-LQFQNGICSA-N |
| XLogP | 7.85 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |