C38H33N3O3 — CID 10370990
[(10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(1-tritylimidazol-4-yl)methyl] acetate (PubChem CID 10370990) has the molecular formula C38H33N3O3 and a molecular weight of 579.70 g/mol. Its IUPAC name is [(10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(1-tritylimidazol-4-yl)methyl] acetate.
| Compound Name | [(10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(1-tritylimidazol-4-yl)methyl] acetate |
|---|---|
| PubChem CID | 10370990 |
| Molecular Formula | C38H33N3O3 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | [(10-methyl-6-oxo-8,9-dihydro-7H-pyrido[1,2-a]indol-7-yl)-(1-tritylimidazol-4-yl)methyl] acetate |
| SMILES | CC(=O)OC(c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C1CCc2c(C)c3ccccc3n2C1=O |
| InChI | InChI=1S/C38H33N3O3/c1-26-31-20-12-13-21-35(31)41-34(26)23-22-32(37(41)43)36(44-27(2)42)33-24-40(25-39-33)38(28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-21,24-25,32,36H,22-23H2,1-2H3 |
| InChIKey | XKDJELLNHWWPSJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|