C14H21ClN2O2 — CID 103709965
1-(4-chlorophenyl)-3-[2-(2-hydroxyethyl)pentyl]urea (PubChem CID 103709965) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[2-(2-hydroxyethyl)pentyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[2-(2-hydroxyethyl)pentyl]urea |
|---|---|
| PubChem CID | 103709965 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-(2-hydroxyethyl)pentyl]urea |
| SMILES | CCCC(CCO)CNC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-2-3-11(8-9-18)10-16-14(19)17-13-6-4-12(15)5-7-13/h4-7,11,18H,2-3,8-10H2,1H3,(H2,16,17,19) |
| InChIKey | BHZYZSIDZQJFJJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |