C10H19F3N2O2 — CID 103710062
1-[2-(2-hydroxyethyl)pentyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 103710062) has the molecular formula C10H19F3N2O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethyl)pentyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(2-hydroxyethyl)pentyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 103710062 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[2-(2-hydroxyethyl)pentyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCCC(CCO)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-2-3-8(4-5-16)6-14-9(17)15-7-10(11,12)13/h8,16H,2-7H2,1H3,(H2,14,15,17) |
| InChIKey | DKSOMDFUEPSRNH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |