C33H33NO4Se — CID 10371112
4-[2-[[8,8-dimethyl-5-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid (PubChem CID 10371112) has the molecular formula C33H33NO4Se and a molecular weight of 586.59 g/mol. Its IUPAC name is 4-[2-[[8,8-dimethyl-5-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[[8,8-dimethyl-5-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 10371112 |
| Molecular Formula | C33H33NO4Se |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 4-[2-[[8,8-dimethyl-5-[4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]phenyl]-7H-naphthalen-2-yl]selanyl]ethynyl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)CNc1ccc(C2=CCC(C)(C)c3cc([Se]C#Cc4ccc(C(=O)O)cc4)ccc32)cc1 |
| InChI | InChI=1S/C33H33NO4Se/c1-32(2,3)38-30(35)21-34-25-12-10-23(11-13-25)27-16-18-33(4,5)29-20-26(14-15-28(27)29)39-19-17-22-6-8-24(9-7-22)31(36)37/h6-16,20,34H,18,21H2,1-5H3,(H,36,37) |
| InChIKey | OWXNWXQEWKMBQI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|