C15H15N3O — CID 103713378
N-[(1-methylpyrrol-2-yl)methyl]-1H-indole-6-carboxamide (PubChem CID 103713378) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-1H-indole-6-carboxamide.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 103713378 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-1H-indole-6-carboxamide |
| SMILES | Cn1cccc1CNC(=O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C15H15N3O/c1-18-8-2-3-13(18)10-17-15(19)12-5-4-11-6-7-16-14(11)9-12/h2-9,16H,10H2,1H3,(H,17,19) |
| InChIKey | FKWIDYXHJAWWIU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |