C30H30F3N3O5S — CID 10371399
3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-methyl-N-(4,4,4-trifluorobutyl)indole-5-carboxamide (PubChem CID 10371399) has the molecular formula C30H30F3N3O5S and a molecular weight of 601.65 g/mol. Its IUPAC name is 3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-methyl-N-(4,4,4-trifluorobutyl)indole-5-carboxamide.
| Compound Name | 3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-methyl-N-(4,4,4-trifluorobutyl)indole-5-carboxamide |
|---|---|
| PubChem CID | 10371399 |
| Molecular Formula | C30H30F3N3O5S |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 3-[[2-methoxy-4-[(2-methylphenyl)sulfonylcarbamoyl]phenyl]methyl]-1-methyl-N-(4,4,4-trifluorobutyl)indole-5-carboxamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2C)ccc1Cc1cn(C)c2ccc(C(=O)NCCCC(F)(F)F)cc12 |
| InChI | InChI=1S/C30H30F3N3O5S/c1-19-7-4-5-8-27(19)42(39,40)35-29(38)22-10-9-20(26(17-22)41-3)15-23-18-36(2)25-12-11-21(16-24(23)25)28(37)34-14-6-13-30(31,32)33/h4-5,7-12,16-18H,6,13-15H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | JSFCVGBCAFRFIC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|