C26H24BrNO4 — CID 103714182
2-(4-bromo-3-methylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (PubChem CID 103714182) has the molecular formula C26H24BrNO4 and a molecular weight of 494.39 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid.
| Compound Name | 2-(4-bromo-3-methylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 103714182 |
| Molecular Formula | C26H24BrNO4 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 2-(4-bromo-3-methylphenyl)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| SMILES | CCN(C(=O)OCC1c2ccccc2-c2ccccc21)C(C(=O)O)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C26H24BrNO4/c1-3-28(24(25(29)30)17-12-13-23(27)16(2)14-17)26(31)32-15-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-14,22,24H,3,15H2,1-2H3,(H,29,30) |
| InChIKey | UDKBTTHVWLHGSG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |