About N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine (PubChem CID 103714473) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine.
Molecular Properties
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine |
| PubChem CID | 103714473 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine |
| SMILES | CCc1cnc(CNC(CC)CC)o1 |
| InChI | InChI=1S/C11H20N2O/c1-4-9(5-2)12-8-11-13-7-10(6-3)14-11/h7,9,12H,4-6,8H2,1-3H3 |
| InChIKey | BFAXRJIHZOXHKW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine?
The IUPAC name of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine (CID 103714473) is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine.
What is the SMILES notation for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine?
The canonical SMILES for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine is CCc1cnc(CNC(CC)CC)o1.
What is the InChIKey of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine?
The InChIKey is BFAXRJIHZOXHKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-4-9(5-2)12-8-11-13-7-10(6-3)14-11/h7,9,12H,4-6,8H2,1-3H3.
What are the key properties of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine?
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine has a molecular weight of 196.29 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]pentan-3-amine is sourced from PubChem (CID 103714473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).