C7H7F2N3O2 — CID 103714909
N-(2,2-difluoroethyl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 103714909) has the molecular formula C7H7F2N3O2 and a molecular weight of 203.15 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103714909 |
| Molecular Formula | C7H7F2N3O2 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(NCC(F)F)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C7H7F2N3O2/c8-5(9)3-10-7(14)4-1-2-6(13)12-11-4/h1-2,5H,3H2,(H,10,14)(H,12,13) |
| InChIKey | HFLWCXCHSRXZBO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |