C11H11Br2NO3 — CID 103715740
3-[(4,5-dibromofuran-2-yl)-hydroxymethyl]oxane-3-carbonitrile (PubChem CID 103715740) has the molecular formula C11H11Br2NO3 and a molecular weight of 365.02 g/mol. Its IUPAC name is 3-[(4,5-dibromofuran-2-yl)-hydroxymethyl]oxane-3-carbonitrile.
| Compound Name | 3-[(4,5-dibromofuran-2-yl)-hydroxymethyl]oxane-3-carbonitrile |
|---|---|
| PubChem CID | 103715740 |
| Molecular Formula | C11H11Br2NO3 |
| Molecular Weight | 365.02 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | 3-[(4,5-dibromofuran-2-yl)-hydroxymethyl]oxane-3-carbonitrile |
| SMILES | N#CC1(C(O)c2cc(Br)c(Br)o2)CCCOC1 |
| InChI | InChI=1S/C11H11Br2NO3/c12-7-4-8(17-10(7)13)9(15)11(5-14)2-1-3-16-6-11/h4,9,15H,1-3,6H2 |
| InChIKey | XJEKBYFNULMSJZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.02 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |