C15H21NO2 — CID 103715911
1-[3-(aminomethyl)oxan-3-yl]-2,3-dihydroinden-1-ol (PubChem CID 103715911) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-[3-(aminomethyl)oxan-3-yl]-2,3-dihydroinden-1-ol.
| Compound Name | 1-[3-(aminomethyl)oxan-3-yl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 103715911 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-[3-(aminomethyl)oxan-3-yl]-2,3-dihydroinden-1-ol |
| SMILES | NCC1(C2(O)CCc3ccccc32)CCCOC1 |
| InChI | InChI=1S/C15H21NO2/c16-10-14(7-3-9-18-11-14)15(17)8-6-12-4-1-2-5-13(12)15/h1-2,4-5,17H,3,6-11,16H2 |
| InChIKey | JTBZRDMKSDBZAQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |