C36H38N8O2 — CID 10371603
N-[2-[2-[2-[(6,9-dimethylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-6,9-dimethylphenazine-1-carboxamide (PubChem CID 10371603) has the molecular formula C36H38N8O2 and a molecular weight of 614.75 g/mol. Its IUPAC name is N-[2-[2-[2-[(6,9-dimethylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-6,9-dimethylphenazine-1-carboxamide.
| Compound Name | N-[2-[2-[2-[(6,9-dimethylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-6,9-dimethylphenazine-1-carboxamide |
|---|---|
| PubChem CID | 10371603 |
| Molecular Formula | C36H38N8O2 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | N-[2-[2-[2-[(6,9-dimethylphenazine-1-carbonyl)amino]ethylamino]ethylamino]ethyl]-6,9-dimethylphenazine-1-carboxamide |
| SMILES | Cc1ccc(C)c2nc3c(C(=O)NCCNCCNCCNC(=O)c4cccc5nc6c(C)ccc(C)c6nc45)cccc3nc12 |
| InChI | InChI=1S/C36H38N8O2/c1-21-11-13-23(3)31-29(21)41-27-9-5-7-25(33(27)43-31)35(45)39-19-17-37-15-16-38-18-20-40-36(46)26-8-6-10-28-34(26)44-32-24(4)14-12-22(2)30(32)42-28/h5-14,37-38H,15-20H2,1-4H3,(H,39,45)(H,40,46) |
| InChIKey | OZXKYFCRFMKKAX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|