C30H24N6O6S2 — CID 10371796
1-N',4-N'-bis[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]benzene-1,4-dicarbohydrazide (PubChem CID 10371796) has the molecular formula C30H24N6O6S2 and a molecular weight of 628.69 g/mol. Its IUPAC name is 1-N',4-N'-bis[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]benzene-1,4-dicarbohydrazide.
| Compound Name | 1-N',4-N'-bis[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]benzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 10371796 |
| Molecular Formula | C30H24N6O6S2 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | 1-N',4-N'-bis[(5E)-5-[(4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]benzene-1,4-dicarbohydrazide |
| SMILES | COc1ccc(/C=C2/SC(NNC(=O)c3ccc(C(=O)NNC4=NC(=O)/C(=C\c5ccc(OC)cc5)S4)cc3)=NC2=O)cc1 |
| InChI | InChI=1S/C30H24N6O6S2/c1-41-21-11-3-17(4-12-21)15-23-27(39)31-29(43-23)35-33-25(37)19-7-9-20(10-8-19)26(38)34-36-30-32-28(40)24(44-30)16-18-5-13-22(42-2)14-6-18/h3-16H,1-2H3,(H,33,37)(H,34,38)(H,31,35,39)(H,32,36,40)/b23-15+,24-16+ |
| InChIKey | VDFQHYZKMMBYAO-DFEHQXHXSA-N |
| XLogP | 3.51 |
| TPSA | 159.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|