About 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide
6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide (PubChem CID 103718209) has the molecular formula C13H15N3O2S
and a molecular weight of 277.35 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide |
| PubChem CID | 103718209 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide |
| SMILES | CCC(NC(=O)c1c[nH]c(C)cc1=O)c1nccs1 |
| InChI | InChI=1S/C13H15N3O2S/c1-3-10(13-14-4-5-19-13)16-12(18)9-7-15-8(2)6-11(9)17/h4-7,10H,3H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | AZTQMSRKMNGWDP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide?
The IUPAC name of 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide (CID 103718209) is 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide.
What is the SMILES notation for 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide?
The canonical SMILES for 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide is CCC(NC(=O)c1c[nH]c(C)cc1=O)c1nccs1.
What is the InChIKey of 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide?
The InChIKey is AZTQMSRKMNGWDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S/c1-3-10(13-14-4-5-19-13)16-12(18)9-7-15-8(2)6-11(9)17/h4-7,10H,3H2,1-2H3,(H,15,17)(H,16,18).
What are the key properties of 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide?
6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide has a molecular weight of 277.35 g/mol, XLogP of 2.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-oxo-N-[1-(1,3-thiazol-2-yl)propyl]-1H-pyridine-3-carboxamide is sourced from PubChem (CID 103718209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).