C16H21N3O3 — CID 103718800
tert-butyl 3-cyano-3-(4-methoxyanilino)azetidine-1-carboxylate (PubChem CID 103718800) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl 3-cyano-3-(4-methoxyanilino)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-cyano-3-(4-methoxyanilino)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 103718800 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | tert-butyl 3-cyano-3-(4-methoxyanilino)azetidine-1-carboxylate |
| SMILES | COc1ccc(NC2(C#N)CN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-15(2,3)22-14(20)19-10-16(9-17,11-19)18-12-5-7-13(21-4)8-6-12/h5-8,18H,10-11H2,1-4H3 |
| InChIKey | HLEFBXJLOQCUDM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|