C15H21N3O2 — CID 103719083
N-(2-hydroxy-4,4-dimethylpentyl)-1H-indazole-5-carboxamide (PubChem CID 103719083) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(2-hydroxy-4,4-dimethylpentyl)-1H-indazole-5-carboxamide.
| Compound Name | N-(2-hydroxy-4,4-dimethylpentyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 103719083 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-(2-hydroxy-4,4-dimethylpentyl)-1H-indazole-5-carboxamide |
| SMILES | CC(C)(C)CC(O)CNC(=O)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,3)7-12(19)9-16-14(20)10-4-5-13-11(6-10)8-17-18-13/h4-6,8,12,19H,7,9H2,1-3H3,(H,16,20)(H,17,18) |
| InChIKey | CXVJKQMCYLFLON-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |