C40H57N5O2 — CID 10371936
2-[(3S)-1-[7-[[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 10371936) has the molecular formula C40H57N5O2 and a molecular weight of 639.93 g/mol. Its IUPAC name is 2-[(3S)-1-[7-[[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[7-[[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 10371936 |
| Molecular Formula | C40H57N5O2 |
| Molecular Weight | 639.93 g/mol |
| Exact Mass | 639.45 |
| IUPAC Name | 2-[(3S)-1-[7-[[1-[(4-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]heptyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | COc1ccncc1CN1CCC(N(CCCCCCCN2CC[C@@H](C(C(N)=O)(c3ccccc3)c3ccccc3)C2)C(C)C)CC1 |
| InChI | InChI=1S/C40H57N5O2/c1-32(2)45(37-21-27-44(28-22-37)30-33-29-42-23-19-38(33)47-3)25-14-6-4-5-13-24-43-26-20-36(31-43)40(39(41)46,34-15-9-7-10-16-34)35-17-11-8-12-18-35/h7-12,15-19,23,29,32,36-37H,4-6,13-14,20-22,24-28,30-31H2,1-3H3,(H2,41,46)/t36-/m1/s1 |
| InChIKey | FJADIVYKWUDMEW-PSXMRANNSA-N |
| XLogP | 6.51 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.93 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|