About Chlorthion
Chlorthion (PubChem CID 10372) has the molecular formula C8H9ClNO5PS
and a molecular weight of 297.65 g/mol. Its IUPAC name is (3-chloro-4-nitrophenoxy)-dimethoxy-sulfanylidene-lambda5-phosphane.
Molecular Properties
| Compound Name | Chlorthion |
| PubChem CID | 10372 |
| Molecular Formula | C8H9ClNO5PS |
| Molecular Weight | 297.65 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | (3-chloro-4-nitrophenoxy)-dimethoxy-sulfanylidene-lambda5-phosphane |
| SMILES | COP(=S)(OC)OC1=CC(=C(C=C1)[N+](=O)[O-])Cl |
| InChI | InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-8(10(11)12)7(9)5-6/h3-5H,1-2H3 |
| InChIKey | NZNRRXXETLSZRO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 106.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | 318 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Chlorthion with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Chlorthion?
The IUPAC name of Chlorthion (CID 10372) is (3-chloro-4-nitrophenoxy)-dimethoxy-sulfanylidene-lambda5-phosphane.
What is the SMILES notation for Chlorthion?
The canonical SMILES for Chlorthion is COP(=S)(OC)OC1=CC(=C(C=C1)[N+](=O)[O-])Cl.
What is the InChIKey of Chlorthion?
The InChIKey is NZNRRXXETLSZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-8(10(11)12)7(9)5-6/h3-5H,1-2H3.
What are the key properties of Chlorthion?
Chlorthion has a molecular weight of 297.65 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Chlorthion is sourced from PubChem (CID 10372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).