C41H59N5O2 — CID 10372115
2-[(3S)-1-[8-[[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide (PubChem CID 10372115) has the molecular formula C41H59N5O2 and a molecular weight of 653.96 g/mol. Its IUPAC name is 2-[(3S)-1-[8-[[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[(3S)-1-[8-[[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 10372115 |
| Molecular Formula | C41H59N5O2 |
| Molecular Weight | 653.96 g/mol |
| Exact Mass | 653.47 |
| IUPAC Name | 2-[(3S)-1-[8-[[1-[(2-methoxy-3-pyridinyl)methyl]piperidin-4-yl]-propan-2-ylamino]octyl]pyrrolidin-3-yl]-2,2-diphenylacetamide |
| SMILES | COc1ncccc1CN1CCC(N(CCCCCCCCN2CC[C@@H](C(C(N)=O)(c3ccccc3)c3ccccc3)C2)C(C)C)CC1 |
| InChI | InChI=1S/C41H59N5O2/c1-33(2)46(38-23-29-45(30-24-38)31-34-17-16-25-43-39(34)48-3)27-15-7-5-4-6-14-26-44-28-22-37(32-44)41(40(42)47,35-18-10-8-11-19-35)36-20-12-9-13-21-36/h8-13,16-21,25,33,37-38H,4-7,14-15,22-24,26-32H2,1-3H3,(H2,42,47)/t37-/m1/s1 |
| InChIKey | YCWZTFKJKYVWKX-DIPNUNPCSA-N |
| XLogP | 6.90 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.96 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|