C12H18N2OS — CID 103721506
5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylpentanenitrile (PubChem CID 103721506) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 103721506 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-2,2-dimethylpentanenitrile |
| SMILES | Cc1nc(SCCCC(C)(C)C#N)oc1C |
| InChI | InChI=1S/C12H18N2OS/c1-9-10(2)15-11(14-9)16-7-5-6-12(3,4)8-13/h5-7H2,1-4H3 |
| InChIKey | RDELHMJSVAEXPR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|