C19H34Cl2O12P2 — CID 10372194
[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 10372194) has the molecular formula C19H34Cl2O12P2 and a molecular weight of 587.32 g/mol. Its IUPAC name is [bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
| Compound Name | [bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 10372194 |
| Molecular Formula | C19H34Cl2O12P2 |
| Molecular Weight | 587.32 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | [bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)C(Cl)(Cl)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H34Cl2O12P2/c1-16(2,3)13(22)28-10-31-34(25,26)19(20,21)35(27,32-11-29-14(23)17(4,5)6)33-12-30-15(24)18(7,8)9/h10-12H2,1-9H3,(H,25,26) |
| InChIKey | QTKOFIRUVOWHOA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.32 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|