C35H26F3O6PS — CID 10372219
[1-[2-bis(4-methoxyphenyl)phosphorylnaphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 10372219) has the molecular formula C35H26F3O6PS and a molecular weight of 662.62 g/mol. Its IUPAC name is [1-[2-bis(4-methoxyphenyl)phosphorylnaphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-[2-bis(4-methoxyphenyl)phosphorylnaphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10372219 |
| Molecular Formula | C35H26F3O6PS |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 662.11 |
| IUPAC Name | [1-[2-bis(4-methoxyphenyl)phosphorylnaphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(P(=O)(c2ccc(OC)cc2)c2ccc3ccccc3c2-c2c(OS(=O)(=O)C(F)(F)F)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C35H26F3O6PS/c1-42-25-13-17-27(18-14-25)45(39,28-19-15-26(43-2)16-20-28)32-22-12-24-8-4-6-10-30(24)34(32)33-29-9-5-3-7-23(29)11-21-31(33)44-46(40,41)35(36,37)38/h3-22H,1-2H3 |
| InChIKey | VIBVXSWAHAYLBM-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|