About 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide
2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide (PubChem CID 103723214) has the molecular formula C7H12F3NO4S
and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide.
Molecular Properties
| Compound Name | 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
| PubChem CID | 103723214 |
| Molecular Formula | C7H12F3NO4S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide |
| SMILES | CC(C(=O)NCC(O)C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C7H12F3NO4S/c1-4(16(2,14)15)6(13)11-3-5(12)7(8,9)10/h4-5,12H,3H2,1-2H3,(H,11,13) |
| InChIKey | WEURYHQLQKEYFZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide?
The IUPAC name of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide (CID 103723214) is 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide.
What is the SMILES notation for 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide?
The canonical SMILES for 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide is CC(C(=O)NCC(O)C(F)(F)F)S(C)(=O)=O.
What is the InChIKey of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide?
The InChIKey is WEURYHQLQKEYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO4S/c1-4(16(2,14)15)6(13)11-3-5(12)7(8,9)10/h4-5,12H,3H2,1-2H3,(H,11,13).
What are the key properties of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide?
2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide has a molecular weight of 263.24 g/mol, XLogP of -0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)propanamide is sourced from PubChem (CID 103723214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).