C10H14F3NO2 — CID 103723249
2-cyclopent-2-en-1-yl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide (PubChem CID 103723249) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-cyclopent-2-en-1-yl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide.
| Compound Name | 2-cyclopent-2-en-1-yl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 103723249 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-cyclopent-2-en-1-yl-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
| SMILES | O=C(CC1C=CCC1)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO2/c11-10(12,13)8(15)6-14-9(16)5-7-3-1-2-4-7/h1,3,7-8,15H,2,4-6H2,(H,14,16) |
| InChIKey | FAIKIWZYWLARGI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|