C44H55N3O3 — CID 10372332
[1-[4-[4-[(2S)-2-benzhydrylpyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10372332) has the molecular formula C44H55N3O3 and a molecular weight of 673.94 g/mol. Its IUPAC name is [1-[4-[4-[(2S)-2-benzhydrylpyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[4-[4-[(2S)-2-benzhydrylpyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10372332 |
| Molecular Formula | C44H55N3O3 |
| Molecular Weight | 673.94 g/mol |
| Exact Mass | 673.42 |
| IUPAC Name | [1-[4-[4-[(2S)-2-benzhydrylpyrrolidin-1-yl]butoxy]butyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CC1(OC(=O)Nc2ccccc2-c2ccccc2)CCN(CCCCOCCCCN2CCC[C@H]2C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C44H55N3O3/c1-44(50-43(48)45-40-25-12-11-24-39(40)36-18-5-2-6-19-36)27-32-46(33-28-44)29-13-15-34-49-35-16-14-30-47-31-17-26-41(47)42(37-20-7-3-8-21-37)38-22-9-4-10-23-38/h2-12,18-25,41-42H,13-17,26-35H2,1H3,(H,45,48)/t41-/m0/s1 |
| InChIKey | VTYNCZNMQRCMCW-RWYGWLOXSA-N |
| XLogP | 9.63 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.94 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|