C16H31N3O3 — CID 103723630
tert-butyl 2-[2-[(4-amino-4-oxobutyl)amino]propyl]pyrrolidine-1-carboxylate (PubChem CID 103723630) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl 2-[2-[(4-amino-4-oxobutyl)amino]propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[(4-amino-4-oxobutyl)amino]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103723630 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | tert-butyl 2-[2-[(4-amino-4-oxobutyl)amino]propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(CC1CCCN1C(=O)OC(C)(C)C)NCCCC(N)=O |
| InChI | InChI=1S/C16H31N3O3/c1-12(18-9-5-8-14(17)20)11-13-7-6-10-19(13)15(21)22-16(2,3)4/h12-13,18H,5-11H2,1-4H3,(H2,17,20) |
| InChIKey | HQVCHYBCKPKFCF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|