C17H24N2O3 — CID 103724076
tert-butyl 2-(2-oxo-2-pyridin-4-ylethyl)piperidine-1-carboxylate (PubChem CID 103724076) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl 2-(2-oxo-2-pyridin-4-ylethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-oxo-2-pyridin-4-ylethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103724076 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl 2-(2-oxo-2-pyridin-4-ylethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CC(=O)c1ccncc1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)22-16(21)19-11-5-4-6-14(19)12-15(20)13-7-9-18-10-8-13/h7-10,14H,4-6,11-12H2,1-3H3 |
| InChIKey | WBDRGELASTVLBU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |