About 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide
3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide (PubChem CID 103724912) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide |
| PubChem CID | 103724912 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide |
| SMILES | CNC(=O)C(C)CN(C)c1nc(C)cc(C)c1C#N |
| InChI | InChI=1S/C14H20N4O/c1-9-6-11(3)17-13(12(9)7-15)18(5)8-10(2)14(19)16-4/h6,10H,8H2,1-5H3,(H,16,19) |
| InChIKey | HMTWLGNIZSWLIJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide?
The IUPAC name of 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide (CID 103724912) is 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide.
What is the SMILES notation for 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide?
The canonical SMILES for 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide is CNC(=O)C(C)CN(C)c1nc(C)cc(C)c1C#N.
What is the InChIKey of 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide?
The InChIKey is HMTWLGNIZSWLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O/c1-9-6-11(3)17-13(12(9)7-15)18(5)8-10(2)14(19)16-4/h6,10H,8H2,1-5H3,(H,16,19).
What are the key properties of 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide?
3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide has a molecular weight of 260.34 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)-methylamino]-N,2-dimethylpropanamide is sourced from PubChem (CID 103724912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).