C10H16N4O — CID 103725330
2-cyclobutyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]acetamide (PubChem CID 103725330) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-cyclobutyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]acetamide.
| Compound Name | 2-cyclobutyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103725330 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-cyclobutyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
| SMILES | O=C(CC1CCC1)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C10H16N4O/c15-10(6-8-2-1-3-8)11-5-4-9-12-7-13-14-9/h7-8H,1-6H2,(H,11,15)(H,12,13,14) |
| InChIKey | OYWWADKLBHWSOV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |