C36H74O5Si4 — CID 10372552
(2E,4R,6E,8S,9S,10E)-4,8,9,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,10-trien-5-one (PubChem CID 10372552) has the molecular formula C36H74O5Si4 and a molecular weight of 699.33 g/mol. Its IUPAC name is (2E,4R,6E,8S,9S,10E)-4,8,9,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,10-trien-5-one.
| Compound Name | (2E,4R,6E,8S,9S,10E)-4,8,9,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,10-trien-5-one |
|---|---|
| PubChem CID | 10372552 |
| Molecular Formula | C36H74O5Si4 |
| Molecular Weight | 699.33 g/mol |
| Exact Mass | 698.46 |
| IUPAC Name | (2E,4R,6E,8S,9S,10E)-4,8,9,12-tetrakis[[tert-butyl(dimethyl)silyl]oxy]dodeca-2,6,10-trien-5-one |
| SMILES | C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H74O5Si4/c1-22-24-30(39-43(16,17)34(5,6)7)29(37)26-27-32(41-45(20,21)36(11,12)13)31(40-44(18,19)35(8,9)10)25-23-28-38-42(14,15)33(2,3)4/h22-27,30-32H,28H2,1-21H3/b24-22+,25-23+,27-26+/t30-,31+,32+/m1/s1 |
| InChIKey | XDLDBLSYCRVMCI-KNEPFUBNSA-N |
| XLogP | 11.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.33 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|