About N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide
N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide (PubChem CID 103726156) has the molecular formula C8H12F3NO2S
and a molecular weight of 243.25 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide.
Molecular Properties
| Compound Name | N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide |
| PubChem CID | 103726156 |
| Molecular Formula | C8H12F3NO2S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide |
| SMILES | O=C(NCC(O)C(F)(F)F)C1CCCS1 |
| InChI | InChI=1S/C8H12F3NO2S/c9-8(10,11)6(13)4-12-7(14)5-2-1-3-15-5/h5-6,13H,1-4H2,(H,12,14) |
| InChIKey | YHVGJAQWOFRZRV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide?
The IUPAC name of N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide (CID 103726156) is N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide.
What is the SMILES notation for N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide?
The canonical SMILES for N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide is O=C(NCC(O)C(F)(F)F)C1CCCS1.
What is the InChIKey of N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide?
The InChIKey is YHVGJAQWOFRZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO2S/c9-8(10,11)6(13)4-12-7(14)5-2-1-3-15-5/h5-6,13H,1-4H2,(H,12,14).
What are the key properties of N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide?
N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide has a molecular weight of 243.25 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3,3-trifluoro-2-hydroxypropyl)thiolane-2-carboxamide is sourced from PubChem (CID 103726156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).