C39H37ClF3N3O2 — CID 10372622
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 10372622) has the molecular formula C39H37ClF3N3O2 and a molecular weight of 672.19 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 10372622 |
| Molecular Formula | C39H37ClF3N3O2 |
| Molecular Weight | 672.19 g/mol |
| Exact Mass | 671.25 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1)NCc1ccccn1 |
| InChI | InChI=1S/C39H37ClF3N3O2/c40-38-32(17-10-20-36(38)39(41,42)43)27-46(28-35(30-13-3-1-4-14-30)31-15-5-2-6-16-31)22-11-23-48-34-19-9-12-29(24-34)25-37(47)45-26-33-18-7-8-21-44-33/h1-10,12-21,24,35H,11,22-23,25-28H2,(H,45,47) |
| InChIKey | NRXITTYWWDPXFP-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.19 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|