C9H16F3NO2 — CID 103726292
2,2-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide (PubChem CID 103726292) has the molecular formula C9H16F3NO2 and a molecular weight of 227.23 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide.
| Compound Name | 2,2-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide |
|---|---|
| PubChem CID | 103726292 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2,2-dimethyl-N-(3,3,3-trifluoro-2-hydroxypropyl)butanamide |
| SMILES | CCC(C)(C)C(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2/c1-4-8(2,3)7(15)13-5-6(14)9(10,11)12/h6,14H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | UAADYVGVYCFKAU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |