About 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide
1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide (PubChem CID 103726390) has the molecular formula C11H17F3N2O3
and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide |
| PubChem CID | 103726390 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCC(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O3/c1-7(17)16-4-2-8(3-5-16)10(19)15-6-9(18)11(12,13)14/h8-9,18H,2-6H2,1H3,(H,15,19) |
| InChIKey | CRIJCYHSDZAMMF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide?
The IUPAC name of 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide (CID 103726390) is 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide.
What is the SMILES notation for 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide?
The canonical SMILES for 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide is CC(=O)N1CCC(C(=O)NCC(O)C(F)(F)F)CC1.
What is the InChIKey of 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide?
The InChIKey is CRIJCYHSDZAMMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O3/c1-7(17)16-4-2-8(3-5-16)10(19)15-6-9(18)11(12,13)14/h8-9,18H,2-6H2,1H3,(H,15,19).
What are the key properties of 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide?
1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide has a molecular weight of 282.26 g/mol, XLogP of 0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-4-carboxamide is sourced from PubChem (CID 103726390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).