About 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide
5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide (PubChem CID 103726423) has the molecular formula C8H7F3INO2S
and a molecular weight of 365.11 g/mol. Its IUPAC name is 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide |
| PubChem CID | 103726423 |
| Molecular Formula | C8H7F3INO2S |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1csc(I)c1 |
| InChI | InChI=1S/C8H7F3INO2S/c9-8(10,11)5(14)2-13-7(15)4-1-6(12)16-3-4/h1,3,5,14H,2H2,(H,13,15) |
| InChIKey | CFEMZVSQPPMKFT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide?
The IUPAC name of 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide (CID 103726423) is 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide.
What is the SMILES notation for 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide?
The canonical SMILES for 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide is O=C(NCC(O)C(F)(F)F)c1csc(I)c1.
What is the InChIKey of 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide?
The InChIKey is CFEMZVSQPPMKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3INO2S/c9-8(10,11)5(14)2-13-7(15)4-1-6(12)16-3-4/h1,3,5,14H,2H2,(H,13,15).
What are the key properties of 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide?
5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide has a molecular weight of 365.11 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N-(3,3,3-trifluoro-2-hydroxypropyl)thiophene-3-carboxamide is sourced from PubChem (CID 103726423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).