C13H11F3N2O2 — CID 103726459
N-(3,3,3-trifluoro-2-hydroxypropyl)quinoline-6-carboxamide (PubChem CID 103726459) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-hydroxypropyl)quinoline-6-carboxamide.
| Compound Name | N-(3,3,3-trifluoro-2-hydroxypropyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 103726459 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(3,3,3-trifluoro-2-hydroxypropyl)quinoline-6-carboxamide |
| SMILES | O=C(NCC(O)C(F)(F)F)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C13H11F3N2O2/c14-13(15,16)11(19)7-18-12(20)9-3-4-10-8(6-9)2-1-5-17-10/h1-6,11,19H,7H2,(H,18,20) |
| InChIKey | XTDKBCYDXVLUMZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |