C11H16BrN3O2 — CID 103726655
[1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]methanol (PubChem CID 103726655) has the molecular formula C11H16BrN3O2 and a molecular weight of 302.17 g/mol. Its IUPAC name is [1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]methanol.
| Compound Name | [1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 103726655 |
| Molecular Formula | C11H16BrN3O2 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]methanol |
| SMILES | COc1nc(N2CCC(CO)CC2)ncc1Br |
| InChI | InChI=1S/C11H16BrN3O2/c1-17-10-9(12)6-13-11(14-10)15-4-2-8(7-16)3-5-15/h6,8,16H,2-5,7H2,1H3 |
| InChIKey | JRSXGTURWQSWCK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |