C9H17NO2S — CID 103726884
1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylpropan-1-one (PubChem CID 103726884) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylpropan-1-one.
| Compound Name | 1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylpropan-1-one |
|---|---|
| PubChem CID | 103726884 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 1-(3-hydroxy-3-methylpyrrolidin-1-yl)-3-methylsulfanylpropan-1-one |
| SMILES | CSCCC(=O)N1CCC(C)(O)C1 |
| InChI | InChI=1S/C9H17NO2S/c1-9(12)4-5-10(7-9)8(11)3-6-13-2/h12H,3-7H2,1-2H3 |
| InChIKey | ROVFNNYRVQEUQH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |